C26H21NO — CID 58197525
6-(3-isocyanophenyl)spiro[3H-indene-2,6'-5,7,8,9-tetrahydrobenzo[7]annulene]-1-one (PubChem CID 58197525) has the molecular formula C26H21NO and a molecular weight of 363.46 g/mol. Its IUPAC name is 6-(3-isocyanophenyl)spiro[3H-indene-2,6'-5,7,8,9-tetrahydrobenzo[7]annulene]-1-one.
| Compound Name | 6-(3-isocyanophenyl)spiro[3H-indene-2,6'-5,7,8,9-tetrahydrobenzo[7]annulene]-1-one |
|---|---|
| PubChem CID | 58197525 |
| Molecular Formula | C26H21NO |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 6-(3-isocyanophenyl)spiro[3H-indene-2,6'-5,7,8,9-tetrahydrobenzo[7]annulene]-1-one |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)C(=O)C2(CCCc4ccccc4C2)C3)c1 |
| InChI | InChI=1S/C26H21NO/c1-27-23-10-4-8-19(14-23)20-11-12-22-17-26(25(28)24(22)15-20)13-5-9-18-6-2-3-7-21(18)16-26/h2-4,6-8,10-12,14-15H,5,9,13,16-17H2 |
| InChIKey | TVZIERFMQMMTTE-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|