About 6-(3-isocyanophenyl)spiro[2H-indene-3,4'-oxane]-1-one
6-(3-isocyanophenyl)spiro[2H-indene-3,4'-oxane]-1-one (PubChem CID 58197535) has the molecular formula C20H17NO2
and a molecular weight of 303.36 g/mol. Its IUPAC name is 6-(3-isocyanophenyl)spiro[2H-indene-3,4'-oxane]-1-one.
Molecular Properties
| Compound Name | 6-(3-isocyanophenyl)spiro[2H-indene-3,4'-oxane]-1-one |
| PubChem CID | 58197535 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 6-(3-isocyanophenyl)spiro[2H-indene-3,4'-oxane]-1-one |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)C(=O)CC32CCOCC2)c1 |
| InChI | InChI=1S/C20H17NO2/c1-21-16-4-2-3-14(11-16)15-5-6-18-17(12-15)19(22)13-20(18)7-9-23-10-8-20/h2-6,11-12H,7-10,13H2 |
| InChIKey | LQFBLRFYJYABOM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-isocyanophenyl)spiro[2H-indene-3,4'-oxane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-isocyanophenyl)spiro[2H-indene-3,4'-oxane]-1-one?
The IUPAC name of 6-(3-isocyanophenyl)spiro[2H-indene-3,4'-oxane]-1-one (CID 58197535) is 6-(3-isocyanophenyl)spiro[2H-indene-3,4'-oxane]-1-one.
What is the SMILES notation for 6-(3-isocyanophenyl)spiro[2H-indene-3,4'-oxane]-1-one?
The canonical SMILES for 6-(3-isocyanophenyl)spiro[2H-indene-3,4'-oxane]-1-one is [C-]#[N+]c1cccc(-c2ccc3c(c2)C(=O)CC32CCOCC2)c1.
What is the InChIKey of 6-(3-isocyanophenyl)spiro[2H-indene-3,4'-oxane]-1-one?
The InChIKey is LQFBLRFYJYABOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO2/c1-21-16-4-2-3-14(11-16)15-5-6-18-17(12-15)19(22)13-20(18)7-9-23-10-8-20/h2-6,11-12H,7-10,13H2.
What are the key properties of 6-(3-isocyanophenyl)spiro[2H-indene-3,4'-oxane]-1-one?
6-(3-isocyanophenyl)spiro[2H-indene-3,4'-oxane]-1-one has a molecular weight of 303.36 g/mol, XLogP of 4.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-isocyanophenyl)spiro[2H-indene-3,4'-oxane]-1-one is sourced from PubChem (CID 58197535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).