C26H28N4O2 — CID 58197581
CID 58197581 (PubChem CID 58197581) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol.
| Compound Name | CID 58197581 |
|---|---|
| PubChem CID | 58197581 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(-c3cccc(C#N)c3)cc1C21CC(=O)N(C)C(N)=N1 |
| InChI | InChI=1S/C26H28N4O2/c1-30-23(31)15-26(29-24(30)28)22-13-19(18-5-3-4-17(12-18)16-27)6-7-20(22)14-25(26)10-8-21(32-2)9-11-25/h3-7,12-13,21H,8-11,14-15H2,1-2H3,(H2,28,29) |
| InChIKey | PFWUIIHFJCWRDR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 91.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |