About 6'-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-one
6'-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-one (PubChem CID 58197583) has the molecular formula C18H15BrO
and a molecular weight of 327.22 g/mol. Its IUPAC name is 6'-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-one.
Molecular Properties
| Compound Name | 6'-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-one |
| PubChem CID | 58197583 |
| Molecular Formula | C18H15BrO |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 6'-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-one |
| SMILES | O=C1c2cc(Br)ccc2CC12CCc1ccccc1C2 |
| InChI | InChI=1S/C18H15BrO/c19-15-6-5-14-11-18(17(20)16(14)9-15)8-7-12-3-1-2-4-13(12)10-18/h1-6,9H,7-8,10-11H2 |
| InChIKey | NPDFCMNICKTWFJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6'-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6'-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-one?
The IUPAC name of 6'-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-one (CID 58197583) is 6'-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-one.
What is the SMILES notation for 6'-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-one?
The canonical SMILES for 6'-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-one is O=C1c2cc(Br)ccc2CC12CCc1ccccc1C2.
What is the InChIKey of 6'-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-one?
The InChIKey is NPDFCMNICKTWFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrO/c19-15-6-5-14-11-18(17(20)16(14)9-15)8-7-12-3-1-2-4-13(12)10-18/h1-6,9H,7-8,10-11H2.
What are the key properties of 6'-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-one?
6'-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-one has a molecular weight of 327.22 g/mol, XLogP of 4.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6'-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-one is sourced from PubChem (CID 58197583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).