About 7-bromo-4-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one
7-bromo-4-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one (PubChem CID 58197703) has the molecular formula C15H16BrFO2
and a molecular weight of 327.19 g/mol. Its IUPAC name is 7-bromo-4-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one.
Molecular Properties
| Compound Name | 7-bromo-4-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one |
| PubChem CID | 58197703 |
| Molecular Formula | C15H16BrFO2 |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 7-bromo-4-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one |
| SMILES | COC1CCC2(CC1)Cc1c(F)ccc(Br)c1C2=O |
| InChI | InChI=1S/C15H16BrFO2/c1-19-9-4-6-15(7-5-9)8-10-12(17)3-2-11(16)13(10)14(15)18/h2-3,9H,4-8H2,1H3 |
| InChIKey | QOYXIGLDSREAPT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-4-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-4-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one?
The IUPAC name of 7-bromo-4-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one (CID 58197703) is 7-bromo-4-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one.
What is the SMILES notation for 7-bromo-4-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one?
The canonical SMILES for 7-bromo-4-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one is COC1CCC2(CC1)Cc1c(F)ccc(Br)c1C2=O.
What is the InChIKey of 7-bromo-4-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one?
The InChIKey is QOYXIGLDSREAPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16BrFO2/c1-19-9-4-6-15(7-5-9)8-10-12(17)3-2-11(16)13(10)14(15)18/h2-3,9H,4-8H2,1H3.
What are the key properties of 7-bromo-4-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one?
7-bromo-4-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one has a molecular weight of 327.19 g/mol, XLogP of 3.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-4-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one is sourced from PubChem (CID 58197703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).