C19H17ClIN — CID 58197710
7-[(4-chloro-2-iodophenyl)methyl]-5,6,8,9-tetrahydrobenzo[7]annulene-7-carbonitrile (PubChem CID 58197710) has the molecular formula C19H17ClIN and a molecular weight of 421.71 g/mol. Its IUPAC name is 7-[(4-chloro-2-iodophenyl)methyl]-5,6,8,9-tetrahydrobenzo[7]annulene-7-carbonitrile.
| Compound Name | 7-[(4-chloro-2-iodophenyl)methyl]-5,6,8,9-tetrahydrobenzo[7]annulene-7-carbonitrile |
|---|---|
| PubChem CID | 58197710 |
| Molecular Formula | C19H17ClIN |
| Molecular Weight | 421.71 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 7-[(4-chloro-2-iodophenyl)methyl]-5,6,8,9-tetrahydrobenzo[7]annulene-7-carbonitrile |
| SMILES | N#CC1(Cc2ccc(Cl)cc2I)CCc2ccccc2CC1 |
| InChI | InChI=1S/C19H17ClIN/c20-17-6-5-16(18(21)11-17)12-19(13-22)9-7-14-3-1-2-4-15(14)8-10-19/h1-6,11H,7-10,12H2 |
| InChIKey | RBFQTBROEUGPQZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.71 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|