About [4'-methoxy-6-(2-phenylethyl)spiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide
[4'-methoxy-6-(2-phenylethyl)spiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide (PubChem CID 58197803) has the molecular formula C24H26N2O
and a molecular weight of 358.49 g/mol. Its IUPAC name is [4'-methoxy-6-(2-phenylethyl)spiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide.
Molecular Properties
| Compound Name | [4'-methoxy-6-(2-phenylethyl)spiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide |
| PubChem CID | 58197803 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | [4'-methoxy-6-(2-phenylethyl)spiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide |
| SMILES | COC1CCC2(CC1)Cc1ccc(CCc3ccccc3)cc1/C2=N\C#N |
| InChI | InChI=1S/C24H26N2O/c1-27-21-11-13-24(14-12-21)16-20-10-9-19(15-22(20)23(24)26-17-25)8-7-18-5-3-2-4-6-18/h2-6,9-10,15,21H,7-8,11-14,16H2,1H3/b26-23+ |
| InChIKey | ZLYTXVRWPTVPQE-WNAAXNPUSA-N |
| XLogP | 4.87 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [4'-methoxy-6-(2-phenylethyl)spiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4'-methoxy-6-(2-phenylethyl)spiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide?
The IUPAC name of [4'-methoxy-6-(2-phenylethyl)spiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide (CID 58197803) is [4'-methoxy-6-(2-phenylethyl)spiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide.
What is the SMILES notation for [4'-methoxy-6-(2-phenylethyl)spiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide?
The canonical SMILES for [4'-methoxy-6-(2-phenylethyl)spiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide is COC1CCC2(CC1)Cc1ccc(CCc3ccccc3)cc1/C2=N\C#N.
What is the InChIKey of [4'-methoxy-6-(2-phenylethyl)spiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide?
The InChIKey is ZLYTXVRWPTVPQE-WNAAXNPUSA-N. The full InChI is InChI=1S/C24H26N2O/c1-27-21-11-13-24(14-12-21)16-20-10-9-19(15-22(20)23(24)26-17-25)8-7-18-5-3-2-4-6-18/h2-6,9-10,15,21H,7-8,11-14,16H2,1H3/b26-23+.
What are the key properties of [4'-methoxy-6-(2-phenylethyl)spiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide?
[4'-methoxy-6-(2-phenylethyl)spiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide has a molecular weight of 358.49 g/mol, XLogP of 4.87, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4'-methoxy-6-(2-phenylethyl)spiro[3H-indene-2,1'-cyclohexane]-1-ylidene]cyanamide is sourced from PubChem (CID 58197803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).