About 7-(3-isocyanophenyl)-4'-methoxyspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-one
7-(3-isocyanophenyl)-4'-methoxyspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-one (PubChem CID 58197822) has the molecular formula C23H23NO2
and a molecular weight of 345.44 g/mol. Its IUPAC name is 7-(3-isocyanophenyl)-4'-methoxyspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-one.
Molecular Properties
| Compound Name | 7-(3-isocyanophenyl)-4'-methoxyspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-one |
| PubChem CID | 58197822 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 7-(3-isocyanophenyl)-4'-methoxyspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-one |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)C(=O)C2(CC3)CCC(OC)CC2)c1 |
| InChI | InChI=1S/C23H23NO2/c1-24-19-5-3-4-17(14-19)18-7-6-16-8-11-23(22(25)21(16)15-18)12-9-20(26-2)10-13-23/h3-7,14-15,20H,8-13H2,2H3 |
| InChIKey | SNTLUYFCZFNUOO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 7-(3-isocyanophenyl)-4'-methoxyspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-isocyanophenyl)-4'-methoxyspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-one?
The IUPAC name of 7-(3-isocyanophenyl)-4'-methoxyspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-one (CID 58197822) is 7-(3-isocyanophenyl)-4'-methoxyspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-one.
What is the SMILES notation for 7-(3-isocyanophenyl)-4'-methoxyspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-one?
The canonical SMILES for 7-(3-isocyanophenyl)-4'-methoxyspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-one is [C-]#[N+]c1cccc(-c2ccc3c(c2)C(=O)C2(CC3)CCC(OC)CC2)c1.
What is the InChIKey of 7-(3-isocyanophenyl)-4'-methoxyspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-one?
The InChIKey is SNTLUYFCZFNUOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO2/c1-24-19-5-3-4-17(14-19)18-7-6-16-8-11-23(22(25)21(16)15-18)12-9-20(26-2)10-13-23/h3-7,14-15,20H,8-13H2,2H3.
What are the key properties of 7-(3-isocyanophenyl)-4'-methoxyspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-one?
7-(3-isocyanophenyl)-4'-methoxyspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-one has a molecular weight of 345.44 g/mol, XLogP of 5.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-isocyanophenyl)-4'-methoxyspiro[3,4-dihydronaphthalene-2,1'-cyclohexane]-1-one is sourced from PubChem (CID 58197822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).