About [(2R,2'R)-6-bromo-2'-phenylspiro[3H-indene-2,1'-cyclopropane]-1-ylidene]cyanamide
[(2R,2'R)-6-bromo-2'-phenylspiro[3H-indene-2,1'-cyclopropane]-1-ylidene]cyanamide (PubChem CID 58197840) has the molecular formula C18H13BrN2
and a molecular weight of 337.22 g/mol. Its IUPAC name is [(2R,2'R)-6-bromo-2'-phenylspiro[3H-indene-2,1'-cyclopropane]-1-ylidene]cyanamide.
Molecular Properties
| Compound Name | [(2R,2'R)-6-bromo-2'-phenylspiro[3H-indene-2,1'-cyclopropane]-1-ylidene]cyanamide |
| PubChem CID | 58197840 |
| Molecular Formula | C18H13BrN2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | [(2R,2'R)-6-bromo-2'-phenylspiro[3H-indene-2,1'-cyclopropane]-1-ylidene]cyanamide |
| SMILES | N#C/N=C1\c2cc(Br)ccc2C[C@@]12C[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C18H13BrN2/c19-14-7-6-13-9-18(17(21-11-20)15(13)8-14)10-16(18)12-4-2-1-3-5-12/h1-8,16H,9-10H2/b21-17+/t16-,18+/m1/s1 |
| InChIKey | HQAKXIIKWDLLMH-ABUZPSNNSA-N |
| XLogP | 4.45 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [(2R,2'R)-6-bromo-2'-phenylspiro[3H-indene-2,1'-cyclopropane]-1-ylidene]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,2'R)-6-bromo-2'-phenylspiro[3H-indene-2,1'-cyclopropane]-1-ylidene]cyanamide?
The IUPAC name of [(2R,2'R)-6-bromo-2'-phenylspiro[3H-indene-2,1'-cyclopropane]-1-ylidene]cyanamide (CID 58197840) is [(2R,2'R)-6-bromo-2'-phenylspiro[3H-indene-2,1'-cyclopropane]-1-ylidene]cyanamide.
What is the SMILES notation for [(2R,2'R)-6-bromo-2'-phenylspiro[3H-indene-2,1'-cyclopropane]-1-ylidene]cyanamide?
The canonical SMILES for [(2R,2'R)-6-bromo-2'-phenylspiro[3H-indene-2,1'-cyclopropane]-1-ylidene]cyanamide is N#C/N=C1\c2cc(Br)ccc2C[C@@]12C[C@@H]2c1ccccc1.
What is the InChIKey of [(2R,2'R)-6-bromo-2'-phenylspiro[3H-indene-2,1'-cyclopropane]-1-ylidene]cyanamide?
The InChIKey is HQAKXIIKWDLLMH-ABUZPSNNSA-N. The full InChI is InChI=1S/C18H13BrN2/c19-14-7-6-13-9-18(17(21-11-20)15(13)8-14)10-16(18)12-4-2-1-3-5-12/h1-8,16H,9-10H2/b21-17+/t16-,18+/m1/s1.
What are the key properties of [(2R,2'R)-6-bromo-2'-phenylspiro[3H-indene-2,1'-cyclopropane]-1-ylidene]cyanamide?
[(2R,2'R)-6-bromo-2'-phenylspiro[3H-indene-2,1'-cyclopropane]-1-ylidene]cyanamide has a molecular weight of 337.22 g/mol, XLogP of 4.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,2'R)-6-bromo-2'-phenylspiro[3H-indene-2,1'-cyclopropane]-1-ylidene]cyanamide is sourced from PubChem (CID 58197840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).