About 6-bromo-1'-fluorospiro[3H-indene-2,4'-cyclohexene]-1-one
6-bromo-1'-fluorospiro[3H-indene-2,4'-cyclohexene]-1-one (PubChem CID 58197869) has the molecular formula C14H12BrFO
and a molecular weight of 295.15 g/mol. Its IUPAC name is 6-bromo-1'-fluorospiro[3H-indene-2,4'-cyclohexene]-1-one.
Molecular Properties
| Compound Name | 6-bromo-1'-fluorospiro[3H-indene-2,4'-cyclohexene]-1-one |
| PubChem CID | 58197869 |
| Molecular Formula | C14H12BrFO |
| Molecular Weight | 295.15 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 6-bromo-1'-fluorospiro[3H-indene-2,4'-cyclohexene]-1-one |
| SMILES | O=C1c2cc(Br)ccc2CC12CC=C(F)CC2 |
| InChI | InChI=1S/C14H12BrFO/c15-10-2-1-9-8-14(13(17)12(9)7-10)5-3-11(16)4-6-14/h1-3,7H,4-6,8H2 |
| InChIKey | YFQSOAFTZGPUGM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.15 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-1'-fluorospiro[3H-indene-2,4'-cyclohexene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1'-fluorospiro[3H-indene-2,4'-cyclohexene]-1-one?
The IUPAC name of 6-bromo-1'-fluorospiro[3H-indene-2,4'-cyclohexene]-1-one (CID 58197869) is 6-bromo-1'-fluorospiro[3H-indene-2,4'-cyclohexene]-1-one.
What is the SMILES notation for 6-bromo-1'-fluorospiro[3H-indene-2,4'-cyclohexene]-1-one?
The canonical SMILES for 6-bromo-1'-fluorospiro[3H-indene-2,4'-cyclohexene]-1-one is O=C1c2cc(Br)ccc2CC12CC=C(F)CC2.
What is the InChIKey of 6-bromo-1'-fluorospiro[3H-indene-2,4'-cyclohexene]-1-one?
The InChIKey is YFQSOAFTZGPUGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrFO/c15-10-2-1-9-8-14(13(17)12(9)7-10)5-3-11(16)4-6-14/h1-3,7H,4-6,8H2.
What are the key properties of 6-bromo-1'-fluorospiro[3H-indene-2,4'-cyclohexene]-1-one?
6-bromo-1'-fluorospiro[3H-indene-2,4'-cyclohexene]-1-one has a molecular weight of 295.15 g/mol, XLogP of 4.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1'-fluorospiro[3H-indene-2,4'-cyclohexene]-1-one is sourced from PubChem (CID 58197869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).