About 6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one
6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one (PubChem CID 58197995) has the molecular formula C21H17NO
and a molecular weight of 299.37 g/mol. Its IUPAC name is 6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one.
Molecular Properties
| Compound Name | 6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one |
| PubChem CID | 58197995 |
| Molecular Formula | C21H17NO |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)C(=O)C2(CC=CCC2)C3)c1 |
| InChI | InChI=1S/C21H17NO/c1-22-18-7-5-6-15(12-18)16-8-9-17-14-21(10-3-2-4-11-21)20(23)19(17)13-16/h2-3,5-9,12-13H,4,10-11,14H2 |
| InChIKey | QJMUNRZSHSRXIB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one?
The IUPAC name of 6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one (CID 58197995) is 6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one.
What is the SMILES notation for 6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one?
The canonical SMILES for 6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one is [C-]#[N+]c1cccc(-c2ccc3c(c2)C(=O)C2(CC=CCC2)C3)c1.
What is the InChIKey of 6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one?
The InChIKey is QJMUNRZSHSRXIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO/c1-22-18-7-5-6-15(12-18)16-8-9-17-14-21(10-3-2-4-11-21)20(23)19(17)13-16/h2-3,5-9,12-13H,4,10-11,14H2.
What are the key properties of 6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one?
6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one has a molecular weight of 299.37 g/mol, XLogP of 5.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one is sourced from PubChem (CID 58197995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).