C24H22F3NO — CID 58198003
6-(3-isocyanophenyl)-4'-(3,3,3-trifluoropropyl)spiro[3H-indene-2,1'-cyclohexane]-1-one (PubChem CID 58198003) has the molecular formula C24H22F3NO and a molecular weight of 397.44 g/mol. Its IUPAC name is 6-(3-isocyanophenyl)-4'-(3,3,3-trifluoropropyl)spiro[3H-indene-2,1'-cyclohexane]-1-one.
| Compound Name | 6-(3-isocyanophenyl)-4'-(3,3,3-trifluoropropyl)spiro[3H-indene-2,1'-cyclohexane]-1-one |
|---|---|
| PubChem CID | 58198003 |
| Molecular Formula | C24H22F3NO |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 6-(3-isocyanophenyl)-4'-(3,3,3-trifluoropropyl)spiro[3H-indene-2,1'-cyclohexane]-1-one |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)C(=O)C2(CCC(CCC(F)(F)F)CC2)C3)c1 |
| InChI | InChI=1S/C24H22F3NO/c1-28-20-4-2-3-17(13-20)18-5-6-19-15-23(22(29)21(19)14-18)10-7-16(8-11-23)9-12-24(25,26)27/h2-6,13-14,16H,7-12,15H2 |
| InChIKey | LDPXWPGQCOWEPS-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|