About 1'-fluoro-6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one
1'-fluoro-6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one (PubChem CID 58198349) has the molecular formula C21H16FNO
and a molecular weight of 317.36 g/mol. Its IUPAC name is 1'-fluoro-6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one.
Molecular Properties
| Compound Name | 1'-fluoro-6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one |
| PubChem CID | 58198349 |
| Molecular Formula | C21H16FNO |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1'-fluoro-6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)C(=O)C2(CC=C(F)CC2)C3)c1 |
| InChI | InChI=1S/C21H16FNO/c1-23-18-4-2-3-14(11-18)15-5-6-16-13-21(20(24)19(16)12-15)9-7-17(22)8-10-21/h2-7,11-12H,8-10,13H2 |
| InChIKey | PTFOIFSMAIODLN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1'-fluoro-6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-fluoro-6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one?
The IUPAC name of 1'-fluoro-6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one (CID 58198349) is 1'-fluoro-6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one.
What is the SMILES notation for 1'-fluoro-6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one?
The canonical SMILES for 1'-fluoro-6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one is [C-]#[N+]c1cccc(-c2ccc3c(c2)C(=O)C2(CC=C(F)CC2)C3)c1.
What is the InChIKey of 1'-fluoro-6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one?
The InChIKey is PTFOIFSMAIODLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16FNO/c1-23-18-4-2-3-14(11-18)15-5-6-16-13-21(20(24)19(16)12-15)9-7-17(22)8-10-21/h2-7,11-12H,8-10,13H2.
What are the key properties of 1'-fluoro-6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one?
1'-fluoro-6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one has a molecular weight of 317.36 g/mol, XLogP of 5.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-fluoro-6-(3-isocyanophenyl)spiro[3H-indene-2,4'-cyclohexene]-1-one is sourced from PubChem (CID 58198349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).