C27H32F2N2O3 — CID 58199013
4-(1'-cyclobutylspiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl)-2,6-difluoro-N-(2-methoxyethyl)benzamide (PubChem CID 58199013) has the molecular formula C27H32F2N2O3 and a molecular weight of 470.56 g/mol. Its IUPAC name is 4-(1'-cyclobutylspiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl)-2,6-difluoro-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-(1'-cyclobutylspiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl)-2,6-difluoro-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 58199013 |
| Molecular Formula | C27H32F2N2O3 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 4-(1'-cyclobutylspiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl)-2,6-difluoro-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1c(F)cc(-c2ccc3c(c2)CCC2(CCN(C4CCC4)CC2)O3)cc1F |
| InChI | InChI=1S/C27H32F2N2O3/c1-33-14-11-30-26(32)25-22(28)16-20(17-23(25)29)18-5-6-24-19(15-18)7-8-27(34-24)9-12-31(13-10-27)21-3-2-4-21/h5-6,15-17,21H,2-4,7-14H2,1H3,(H,30,32) |
| InChIKey | IYVBRCHDEJOZJT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|