C26H30F2N2O4 — CID 58199130
4-(1'-cyclobutylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)-2,6-difluoro-N-(2-methoxyethyl)benzamide (PubChem CID 58199130) has the molecular formula C26H30F2N2O4 and a molecular weight of 472.53 g/mol. Its IUPAC name is 4-(1'-cyclobutylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)-2,6-difluoro-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-(1'-cyclobutylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)-2,6-difluoro-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 58199130 |
| Molecular Formula | C26H30F2N2O4 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 4-(1'-cyclobutylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-yl)-2,6-difluoro-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1c(F)cc(-c2ccc3c(c2)COC2(CCN(C4CCC4)CC2)O3)cc1F |
| InChI | InChI=1S/C26H30F2N2O4/c1-32-12-9-29-25(31)24-21(27)14-18(15-22(24)28)17-5-6-23-19(13-17)16-33-26(34-23)7-10-30(11-8-26)20-3-2-4-20/h5-6,13-15,20H,2-4,7-12,16H2,1H3,(H,29,31) |
| InChIKey | CBZNGKFXQOSFEF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|