C10H14N2OS — CID 58199522
2-sulfanylidene-5,6,7,8,9,10-hexahydro-1H-cycloocta[d]pyrimidin-4-one (PubChem CID 58199522) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-sulfanylidene-5,6,7,8,9,10-hexahydro-1H-cycloocta[d]pyrimidin-4-one.
| Compound Name | 2-sulfanylidene-5,6,7,8,9,10-hexahydro-1H-cycloocta[d]pyrimidin-4-one |
|---|---|
| PubChem CID | 58199522 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 2-sulfanylidene-5,6,7,8,9,10-hexahydro-1H-cycloocta[d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2c1CCCCCC2 |
| InChI | InChI=1S/C10H14N2OS/c13-9-7-5-3-1-2-4-6-8(7)11-10(14)12-9/h1-6H2,(H2,11,12,13,14) |
| InChIKey | RVWDKWAGIKIEIP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|