C24H29N5O5S — CID 58199607
N-(3-aminopropyl)-N-[[3-[2-[3-(4-hydroxy-3-nitrophenyl)propyl]pyrimidin-4-yl]phenyl]methyl]methanesulfonamide (PubChem CID 58199607) has the molecular formula C24H29N5O5S and a molecular weight of 499.59 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-[[3-[2-[3-(4-hydroxy-3-nitrophenyl)propyl]pyrimidin-4-yl]phenyl]methyl]methanesulfonamide.
| Compound Name | N-(3-aminopropyl)-N-[[3-[2-[3-(4-hydroxy-3-nitrophenyl)propyl]pyrimidin-4-yl]phenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 58199607 |
| Molecular Formula | C24H29N5O5S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N-(3-aminopropyl)-N-[[3-[2-[3-(4-hydroxy-3-nitrophenyl)propyl]pyrimidin-4-yl]phenyl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(CCCN)Cc1cccc(-c2ccnc(CCCc3ccc(O)c([N+](=O)[O-])c3)n2)c1 |
| InChI | InChI=1S/C24H29N5O5S/c1-35(33,34)28(14-4-12-25)17-19-6-2-7-20(15-19)21-11-13-26-24(27-21)8-3-5-18-9-10-23(30)22(16-18)29(31)32/h2,6-7,9-11,13,15-16,30H,3-5,8,12,14,17,25H2,1H3 |
| InChIKey | GKYSCCPUIGDRLF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 152.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|