C26H31N3O — CID 58199608
4-[3-[4-[3-[[(2S)-2-methylpiperazin-1-yl]methyl]phenyl]-2-pyridinyl]propyl]phenol (PubChem CID 58199608) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is 4-[3-[4-[3-[[(2S)-2-methylpiperazin-1-yl]methyl]phenyl]-2-pyridinyl]propyl]phenol.
| Compound Name | 4-[3-[4-[3-[[(2S)-2-methylpiperazin-1-yl]methyl]phenyl]-2-pyridinyl]propyl]phenol |
|---|---|
| PubChem CID | 58199608 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 4-[3-[4-[3-[[(2S)-2-methylpiperazin-1-yl]methyl]phenyl]-2-pyridinyl]propyl]phenol |
| SMILES | C[C@H]1CNCCN1Cc1cccc(-c2ccnc(CCCc3ccc(O)cc3)c2)c1 |
| InChI | InChI=1S/C26H31N3O/c1-20-18-27-14-15-29(20)19-22-5-2-6-23(16-22)24-12-13-28-25(17-24)7-3-4-21-8-10-26(30)11-9-21/h2,5-6,8-13,16-17,20,27,30H,3-4,7,14-15,18-19H2,1H3/t20-/m0/s1 |
| InChIKey | VXCHNDJAHMFJSV-FQEVSTJZSA-N |
| XLogP | 4.42 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |