About N-tert-butyl-1-[2,2-dimethylpropyl(methylidene)-λ4-sulfanyl]methanimine
N-tert-butyl-1-[2,2-dimethylpropyl(methylidene)-λ4-sulfanyl]methanimine (PubChem CID 58200071) has the molecular formula C11H23NS
and a molecular weight of 201.38 g/mol. Its IUPAC name is N-tert-butyl-1-[2,2-dimethylpropyl(methylidene)-λ4-sulfanyl]methanimine.
Molecular Properties
| Compound Name | N-tert-butyl-1-[2,2-dimethylpropyl(methylidene)-λ4-sulfanyl]methanimine |
| PubChem CID | 58200071 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | N-tert-butyl-1-[2,2-dimethylpropyl(methylidene)-λ4-sulfanyl]methanimine |
| SMILES | C=S(/C=N/C(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C11H23NS/c1-10(2,3)8-13(7)9-12-11(4,5)6/h9H,7-8H2,1-6H3/b12-9+ |
| InChIKey | FBHBJBPONCEMBR-FMIVXFBMSA-N |
| XLogP | 3.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-1-[2,2-dimethylpropyl(methylidene)-λ4-sulfanyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1-[2,2-dimethylpropyl(methylidene)-λ4-sulfanyl]methanimine?
The IUPAC name of N-tert-butyl-1-[2,2-dimethylpropyl(methylidene)-λ4-sulfanyl]methanimine (CID 58200071) is N-tert-butyl-1-[2,2-dimethylpropyl(methylidene)-λ4-sulfanyl]methanimine.
What is the SMILES notation for N-tert-butyl-1-[2,2-dimethylpropyl(methylidene)-λ4-sulfanyl]methanimine?
The canonical SMILES for N-tert-butyl-1-[2,2-dimethylpropyl(methylidene)-λ4-sulfanyl]methanimine is C=S(/C=N/C(C)(C)C)CC(C)(C)C.
What is the InChIKey of N-tert-butyl-1-[2,2-dimethylpropyl(methylidene)-λ4-sulfanyl]methanimine?
The InChIKey is FBHBJBPONCEMBR-FMIVXFBMSA-N. The full InChI is InChI=1S/C11H23NS/c1-10(2,3)8-13(7)9-12-11(4,5)6/h9H,7-8H2,1-6H3/b12-9+.
What are the key properties of N-tert-butyl-1-[2,2-dimethylpropyl(methylidene)-λ4-sulfanyl]methanimine?
N-tert-butyl-1-[2,2-dimethylpropyl(methylidene)-λ4-sulfanyl]methanimine has a molecular weight of 201.38 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1-[2,2-dimethylpropyl(methylidene)-λ4-sulfanyl]methanimine is sourced from PubChem (CID 58200071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).