About tert-butyl-[(Z)-4,4-dimethylpent-2-enyl]-methylidene-λ4-sulfane
tert-butyl-[(Z)-4,4-dimethylpent-2-enyl]-methylidene-λ4-sulfane (PubChem CID 58200084) has the molecular formula C12H24S
and a molecular weight of 200.39 g/mol. Its IUPAC name is tert-butyl-[(Z)-4,4-dimethylpent-2-enyl]-methylidene-λ4-sulfane.
Molecular Properties
| Compound Name | tert-butyl-[(Z)-4,4-dimethylpent-2-enyl]-methylidene-λ4-sulfane |
| PubChem CID | 58200084 |
| Molecular Formula | C12H24S |
| Molecular Weight | 200.39 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | tert-butyl-[(Z)-4,4-dimethylpent-2-enyl]-methylidene-λ4-sulfane |
| SMILES | C=S(C/C=C\C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H24S/c1-11(2,3)9-8-10-13(7)12(4,5)6/h8-9H,7,10H2,1-6H3/b9-8- |
| InChIKey | WPNURJSNVVQZET-HJWRWDBZSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(Z)-4,4-dimethylpent-2-enyl]-methylidene-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(Z)-4,4-dimethylpent-2-enyl]-methylidene-λ4-sulfane?
The IUPAC name of tert-butyl-[(Z)-4,4-dimethylpent-2-enyl]-methylidene-λ4-sulfane (CID 58200084) is tert-butyl-[(Z)-4,4-dimethylpent-2-enyl]-methylidene-λ4-sulfane.
What is the SMILES notation for tert-butyl-[(Z)-4,4-dimethylpent-2-enyl]-methylidene-λ4-sulfane?
The canonical SMILES for tert-butyl-[(Z)-4,4-dimethylpent-2-enyl]-methylidene-λ4-sulfane is C=S(C/C=C\C(C)(C)C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(Z)-4,4-dimethylpent-2-enyl]-methylidene-λ4-sulfane?
The InChIKey is WPNURJSNVVQZET-HJWRWDBZSA-N. The full InChI is InChI=1S/C12H24S/c1-11(2,3)9-8-10-13(7)12(4,5)6/h8-9H,7,10H2,1-6H3/b9-8-.
What are the key properties of tert-butyl-[(Z)-4,4-dimethylpent-2-enyl]-methylidene-λ4-sulfane?
tert-butyl-[(Z)-4,4-dimethylpent-2-enyl]-methylidene-λ4-sulfane has a molecular weight of 200.39 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(Z)-4,4-dimethylpent-2-enyl]-methylidene-λ4-sulfane is sourced from PubChem (CID 58200084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).