About 5-(bromomethyl)-1,3-dihydro-2-benzofuran
5-(bromomethyl)-1,3-dihydro-2-benzofuran (PubChem CID 58200106) has the molecular formula C9H9BrO
and a molecular weight of 213.07 g/mol. Its IUPAC name is 5-(bromomethyl)-1,3-dihydro-2-benzofuran.
Molecular Properties
| Compound Name | 5-(bromomethyl)-1,3-dihydro-2-benzofuran |
| PubChem CID | 58200106 |
| Molecular Formula | C9H9BrO |
| Molecular Weight | 213.07 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 5-(bromomethyl)-1,3-dihydro-2-benzofuran |
| SMILES | BrCc1ccc2c(c1)COC2 |
| InChI | InChI=1S/C9H9BrO/c10-4-7-1-2-8-5-11-6-9(8)3-7/h1-3H,4-6H2 |
| InChIKey | CIRVAEJDKAWZIA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.07 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(bromomethyl)-1,3-dihydro-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(bromomethyl)-1,3-dihydro-2-benzofuran?
The IUPAC name of 5-(bromomethyl)-1,3-dihydro-2-benzofuran (CID 58200106) is 5-(bromomethyl)-1,3-dihydro-2-benzofuran.
What is the SMILES notation for 5-(bromomethyl)-1,3-dihydro-2-benzofuran?
The canonical SMILES for 5-(bromomethyl)-1,3-dihydro-2-benzofuran is BrCc1ccc2c(c1)COC2.
What is the InChIKey of 5-(bromomethyl)-1,3-dihydro-2-benzofuran?
The InChIKey is CIRVAEJDKAWZIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO/c10-4-7-1-2-8-5-11-6-9(8)3-7/h1-3H,4-6H2.
What are the key properties of 5-(bromomethyl)-1,3-dihydro-2-benzofuran?
5-(bromomethyl)-1,3-dihydro-2-benzofuran has a molecular weight of 213.07 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(bromomethyl)-1,3-dihydro-2-benzofuran is sourced from PubChem (CID 58200106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).