C20H20ClFN4O3S — CID 58200286
2-[2-chloro-5-[[(5R)-5-(4-fluorophenyl)-7-oxo-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]thiazin-3-yl]amino]-4-methylphenoxy]ethanol (PubChem CID 58200286) has the molecular formula C20H20ClFN4O3S and a molecular weight of 450.92 g/mol. Its IUPAC name is 2-[2-chloro-5-[[(5R)-5-(4-fluorophenyl)-7-oxo-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]thiazin-3-yl]amino]-4-methylphenoxy]ethanol.
| Compound Name | 2-[2-chloro-5-[[(5R)-5-(4-fluorophenyl)-7-oxo-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]thiazin-3-yl]amino]-4-methylphenoxy]ethanol |
|---|---|
| PubChem CID | 58200286 |
| Molecular Formula | C20H20ClFN4O3S |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 2-[2-chloro-5-[[(5R)-5-(4-fluorophenyl)-7-oxo-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]thiazin-3-yl]amino]-4-methylphenoxy]ethanol |
| SMILES | Cc1cc(Cl)c(OCCO)cc1Nc1nnc2n1[C@H](c1ccc(F)cc1)CS(=O)C2 |
| InChI | InChI=1S/C20H20ClFN4O3S/c1-12-8-15(21)18(29-7-6-27)9-16(12)23-20-25-24-19-11-30(28)10-17(26(19)20)13-2-4-14(22)5-3-13/h2-5,8-9,17,27H,6-7,10-11H2,1H3,(H,23,25)/t17-,30?/m0/s1 |
| InChIKey | GWAGQCXMJUUZTD-ZRYJOUNDSA-N |
| XLogP | 3.35 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |