C24H16Cl2FN3O4 — CID 58200335
methyl 2-[6-[2-(3,5-dichloro-4-fluorophenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]acetate (PubChem CID 58200335) has the molecular formula C24H16Cl2FN3O4 and a molecular weight of 500.31 g/mol. Its IUPAC name is methyl 2-[6-[2-(3,5-dichloro-4-fluorophenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]acetate.
| Compound Name | methyl 2-[6-[2-(3,5-dichloro-4-fluorophenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]acetate |
|---|---|
| PubChem CID | 58200335 |
| Molecular Formula | C24H16Cl2FN3O4 |
| Molecular Weight | 500.31 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | methyl 2-[6-[2-(3,5-dichloro-4-fluorophenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]acetate |
| SMILES | COC(=O)Cc1nc2ccc(C3(O)c4ccccc4C(=O)N3c3cc(Cl)c(F)c(Cl)c3)cc2[nH]1 |
| InChI | InChI=1S/C24H16Cl2FN3O4/c1-34-21(31)11-20-28-18-7-6-12(8-19(18)29-20)24(33)15-5-3-2-4-14(15)23(32)30(24)13-9-16(25)22(27)17(26)10-13/h2-10,33H,11H2,1H3,(H,28,29) |
| InChIKey | VMDSTURYFLVMGQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.31 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|