C26H23BBrF2NO4S — CID 58200433
1-(4-bromophenyl)sulfonyl-2-(2,6-difluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 58200433) has the molecular formula C26H23BBrF2NO4S and a molecular weight of 574.25 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-2-(2,6-difluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 1-(4-bromophenyl)sulfonyl-2-(2,6-difluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 58200433 |
| Molecular Formula | C26H23BBrF2NO4S |
| Molecular Weight | 574.25 g/mol |
| Exact Mass | 573.06 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-2-(2,6-difluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | CC1(C)OB(c2ccc3c(c2)cc(-c2c(F)cccc2F)n3S(=O)(=O)c2ccc(Br)cc2)OC1(C)C |
| InChI | InChI=1S/C26H23BBrF2NO4S/c1-25(2)26(3,4)35-27(34-25)17-8-13-22-16(14-17)15-23(24-20(29)6-5-7-21(24)30)31(22)36(32,33)19-11-9-18(28)10-12-19/h5-15H,1-4H3 |
| InChIKey | LVQCFWDEOPRJIT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.25 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|