About (5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate
(5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate (PubChem CID 58200464) has the molecular formula C10H7F3N2O3S2
and a molecular weight of 324.31 g/mol. Its IUPAC name is (5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate |
| PubChem CID | 58200464 |
| Molecular Formula | C10H7F3N2O3S2 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | (5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate |
| SMILES | Cc1sc(-c2ccncc2)nc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H7F3N2O3S2/c1-6-8(18-20(16,17)10(11,12)13)15-9(19-6)7-2-4-14-5-3-7/h2-5H,1H3 |
| InChIKey | FMTFMPYIDQBIEX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate?
The IUPAC name of (5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate (CID 58200464) is (5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate.
What is the SMILES notation for (5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate?
The canonical SMILES for (5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate is Cc1sc(-c2ccncc2)nc1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of (5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate?
The InChIKey is FMTFMPYIDQBIEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3N2O3S2/c1-6-8(18-20(16,17)10(11,12)13)15-9(19-6)7-2-4-14-5-3-7/h2-5H,1H3.
What are the key properties of (5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate?
(5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate has a molecular weight of 324.31 g/mol, XLogP of 2.74, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-pyridin-4-yl-1,3-thiazol-4-yl) trifluoromethanesulfonate is sourced from PubChem (CID 58200464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).