C12H8F6N2O3S2 — CID 58200565
[2-pyridin-3-yl-5-(1,1,1-trifluoropropan-2-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate (PubChem CID 58200565) has the molecular formula C12H8F6N2O3S2 and a molecular weight of 406.33 g/mol. Its IUPAC name is [2-pyridin-3-yl-5-(1,1,1-trifluoropropan-2-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate.
| Compound Name | [2-pyridin-3-yl-5-(1,1,1-trifluoropropan-2-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58200565 |
| Molecular Formula | C12H8F6N2O3S2 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | [2-pyridin-3-yl-5-(1,1,1-trifluoropropan-2-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate |
| SMILES | CC(c1sc(-c2cccnc2)nc1OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H8F6N2O3S2/c1-6(11(13,14)15)8-9(23-25(21,22)12(16,17)18)20-10(24-8)7-3-2-4-19-5-7/h2-6H,1H3 |
| InChIKey | ZKSGPNOGEHAQPY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|