About 2-(2,6-difluorophenyl)-3-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1H-indole
2-(2,6-difluorophenyl)-3-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1H-indole (PubChem CID 58200671) has the molecular formula C20H14F5N3
and a molecular weight of 391.34 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-3-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1H-indole.
Molecular Properties
| Compound Name | 2-(2,6-difluorophenyl)-3-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1H-indole |
| PubChem CID | 58200671 |
| Molecular Formula | C20H14F5N3 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-(2,6-difluorophenyl)-3-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1H-indole |
| SMILES | Cc1c(-c2c(F)cccc2F)[nH]c2ccc(-c3cc(C(F)(F)F)nn3C)cc12 |
| InChI | InChI=1S/C20H14F5N3/c1-10-12-8-11(16-9-17(20(23,24)25)27-28(16)2)6-7-15(12)26-19(10)18-13(21)4-3-5-14(18)22/h3-9,26H,1-2H3 |
| InChIKey | LJOQWZJQAULVDC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,6-difluorophenyl)-3-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorophenyl)-3-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1H-indole?
The IUPAC name of 2-(2,6-difluorophenyl)-3-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1H-indole (CID 58200671) is 2-(2,6-difluorophenyl)-3-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1H-indole.
What is the SMILES notation for 2-(2,6-difluorophenyl)-3-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1H-indole?
The canonical SMILES for 2-(2,6-difluorophenyl)-3-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1H-indole is Cc1c(-c2c(F)cccc2F)[nH]c2ccc(-c3cc(C(F)(F)F)nn3C)cc12.
What is the InChIKey of 2-(2,6-difluorophenyl)-3-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1H-indole?
The InChIKey is LJOQWZJQAULVDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14F5N3/c1-10-12-8-11(16-9-17(20(23,24)25)27-28(16)2)6-7-15(12)26-19(10)18-13(21)4-3-5-14(18)22/h3-9,26H,1-2H3.
What are the key properties of 2-(2,6-difluorophenyl)-3-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1H-indole?
2-(2,6-difluorophenyl)-3-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1H-indole has a molecular weight of 391.34 g/mol, XLogP of 5.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenyl)-3-methyl-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-1H-indole is sourced from PubChem (CID 58200671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).