C10H22N2 — CID 58200949
N',N'-dimethyl-N-(3-methylbut-1-en-2-yl)propane-1,3-diamine (PubChem CID 58200949) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is N',N'-dimethyl-N-(3-methylbut-1-en-2-yl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(3-methylbut-1-en-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 58200949 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | N',N'-dimethyl-N-(3-methylbut-1-en-2-yl)propane-1,3-diamine |
| SMILES | C=C(NCCCN(C)C)C(C)C |
| InChI | InChI=1S/C10H22N2/c1-9(2)10(3)11-7-6-8-12(4)5/h9,11H,3,6-8H2,1-2,4-5H3 |
| InChIKey | HPVAVJIETDWIMS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|