C15H22N2O — CID 58201411
2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[(1S,4S)-2-bicyclo[2.2.2]oct-5-enyl]methanone (PubChem CID 58201411) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[(1S,4S)-2-bicyclo[2.2.2]oct-5-enyl]methanone.
| Compound Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[(1S,4S)-2-bicyclo[2.2.2]oct-5-enyl]methanone |
|---|---|
| PubChem CID | 58201411 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[(1S,4S)-2-bicyclo[2.2.2]oct-5-enyl]methanone |
| SMILES | O=C(C1C[C@H]2C=C[C@@H]1CC2)N1CC2CNCC2C1 |
| InChI | InChI=1S/C15H22N2O/c18-15(14-5-10-1-3-11(14)4-2-10)17-8-12-6-16-7-13(12)9-17/h1,3,10-14,16H,2,4-9H2/t10-,11+,12?,13?,14?/m0/s1 |
| InChIKey | WYRNKYIOZVPWTO-OHGHAHBXSA-N |
| XLogP | 1.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|