C19H25N3O — CID 58201413
3,7-diazabicyclo[3.3.1]nonan-3-yl-(6-pyridin-3-ylcyclohex-3-en-1-yl)methanone (PubChem CID 58201413) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is 3,7-diazabicyclo[3.3.1]nonan-3-yl-(6-pyridin-3-ylcyclohex-3-en-1-yl)methanone.
| Compound Name | 3,7-diazabicyclo[3.3.1]nonan-3-yl-(6-pyridin-3-ylcyclohex-3-en-1-yl)methanone |
|---|---|
| PubChem CID | 58201413 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 3,7-diazabicyclo[3.3.1]nonan-3-yl-(6-pyridin-3-ylcyclohex-3-en-1-yl)methanone |
| SMILES | O=C(C1CC=CCC1c1cccnc1)N1CC2CNCC(C2)C1 |
| InChI | InChI=1S/C19H25N3O/c23-19(22-12-14-8-15(13-22)10-21-9-14)18-6-2-1-5-17(18)16-4-3-7-20-11-16/h1-4,7,11,14-15,17-18,21H,5-6,8-10,12-13H2 |
| InChIKey | ORVVTBWVKXKSQQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|