About 5-(3-methyl-1,2-oxazol-5-yl)-1H-1,2,4-triazol-3-amine
5-(3-methyl-1,2-oxazol-5-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 58201731) has the molecular formula C6H7N5O
and a molecular weight of 165.16 g/mol. Its IUPAC name is 5-(3-methyl-1,2-oxazol-5-yl)-1H-1,2,4-triazol-3-amine.
Analyze 5-(3-methyl-1,2-oxazol-5-yl)-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methyl-1,2-oxazol-5-yl)-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-(3-methyl-1,2-oxazol-5-yl)-1H-1,2,4-triazol-3-amine (CID 58201731) is 5-(3-methyl-1,2-oxazol-5-yl)-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-(3-methyl-1,2-oxazol-5-yl)-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-(3-methyl-1,2-oxazol-5-yl)-1H-1,2,4-triazol-3-amine is Cc1cc(-c2nc(N)n[nH]2)on1.
What is the InChIKey of 5-(3-methyl-1,2-oxazol-5-yl)-1H-1,2,4-triazol-3-amine?
The InChIKey is FRAIPSGOXJLZFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O/c1-3-2-4(12-11-3)5-8-6(7)10-9-5/h2H,1H3,(H3,7,8,9,10).
What are the key properties of 5-(3-methyl-1,2-oxazol-5-yl)-1H-1,2,4-triazol-3-amine?
5-(3-methyl-1,2-oxazol-5-yl)-1H-1,2,4-triazol-3-amine has a molecular weight of 165.16 g/mol, XLogP of 0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methyl-1,2-oxazol-5-yl)-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 58201731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).