About N-(2-hydroxy-4,4-dimethylpentyl)-2-methyl-1H-imidazole-5-sulfonamide
N-(2-hydroxy-4,4-dimethylpentyl)-2-methyl-1H-imidazole-5-sulfonamide (PubChem CID 58201813) has the molecular formula C11H21N3O3S
and a molecular weight of 275.37 g/mol. Its IUPAC name is N-(2-hydroxy-4,4-dimethylpentyl)-2-methyl-1H-imidazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(2-hydroxy-4,4-dimethylpentyl)-2-methyl-1H-imidazole-5-sulfonamide |
| PubChem CID | 58201813 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(2-hydroxy-4,4-dimethylpentyl)-2-methyl-1H-imidazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)NCC(O)CC(C)(C)C)[nH]1 |
| InChI | InChI=1S/C11H21N3O3S/c1-8-12-7-10(14-8)18(16,17)13-6-9(15)5-11(2,3)4/h7,9,13,15H,5-6H2,1-4H3,(H,12,14) |
| InChIKey | JNZDLGMSEVVRRT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-hydroxy-4,4-dimethylpentyl)-2-methyl-1H-imidazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxy-4,4-dimethylpentyl)-2-methyl-1H-imidazole-5-sulfonamide?
The IUPAC name of N-(2-hydroxy-4,4-dimethylpentyl)-2-methyl-1H-imidazole-5-sulfonamide (CID 58201813) is N-(2-hydroxy-4,4-dimethylpentyl)-2-methyl-1H-imidazole-5-sulfonamide.
What is the SMILES notation for N-(2-hydroxy-4,4-dimethylpentyl)-2-methyl-1H-imidazole-5-sulfonamide?
The canonical SMILES for N-(2-hydroxy-4,4-dimethylpentyl)-2-methyl-1H-imidazole-5-sulfonamide is Cc1ncc(S(=O)(=O)NCC(O)CC(C)(C)C)[nH]1.
What is the InChIKey of N-(2-hydroxy-4,4-dimethylpentyl)-2-methyl-1H-imidazole-5-sulfonamide?
The InChIKey is JNZDLGMSEVVRRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O3S/c1-8-12-7-10(14-8)18(16,17)13-6-9(15)5-11(2,3)4/h7,9,13,15H,5-6H2,1-4H3,(H,12,14).
What are the key properties of N-(2-hydroxy-4,4-dimethylpentyl)-2-methyl-1H-imidazole-5-sulfonamide?
N-(2-hydroxy-4,4-dimethylpentyl)-2-methyl-1H-imidazole-5-sulfonamide has a molecular weight of 275.37 g/mol, XLogP of 0.79, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxy-4,4-dimethylpentyl)-2-methyl-1H-imidazole-5-sulfonamide is sourced from PubChem (CID 58201813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).