C8H10F6O4S — CID 58201871
1,1-difluoro-2-[(E)-4-(1,1,2-trifluoroethoxy)but-2-enoxy]ethanesulfonyl fluoride (PubChem CID 58201871) has the molecular formula C8H10F6O4S and a molecular weight of 316.22 g/mol. Its IUPAC name is 1,1-difluoro-2-[(E)-4-(1,1,2-trifluoroethoxy)but-2-enoxy]ethanesulfonyl fluoride.
| Compound Name | 1,1-difluoro-2-[(E)-4-(1,1,2-trifluoroethoxy)but-2-enoxy]ethanesulfonyl fluoride |
|---|---|
| PubChem CID | 58201871 |
| Molecular Formula | C8H10F6O4S |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 1,1-difluoro-2-[(E)-4-(1,1,2-trifluoroethoxy)but-2-enoxy]ethanesulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)COC/C=C/COC(F)(F)CF |
| InChI | InChI=1S/C8H10F6O4S/c9-5-7(10,11)18-4-2-1-3-17-6-8(12,13)19(14,15)16/h1-2H,3-6H2/b2-1+ |
| InChIKey | DQCMIEFMIWCODC-OWOJBTEDSA-N |
| XLogP | 2.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|