C8H10F6O5S — CID 58201881
2,2-difluoro-2-[[3-(1,1,2-trifluoroethoxymethyl)oxiran-2-yl]methoxy]ethanesulfonyl fluoride (PubChem CID 58201881) has the molecular formula C8H10F6O5S and a molecular weight of 332.22 g/mol. Its IUPAC name is 2,2-difluoro-2-[[3-(1,1,2-trifluoroethoxymethyl)oxiran-2-yl]methoxy]ethanesulfonyl fluoride.
| Compound Name | 2,2-difluoro-2-[[3-(1,1,2-trifluoroethoxymethyl)oxiran-2-yl]methoxy]ethanesulfonyl fluoride |
|---|---|
| PubChem CID | 58201881 |
| Molecular Formula | C8H10F6O5S |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2,2-difluoro-2-[[3-(1,1,2-trifluoroethoxymethyl)oxiran-2-yl]methoxy]ethanesulfonyl fluoride |
| SMILES | O=S(=O)(F)CC(F)(F)OCC1OC1COC(F)(F)CF |
| InChI | InChI=1S/C8H10F6O5S/c9-3-7(10,11)17-1-5-6(19-5)2-18-8(12,13)4-20(14,15)16/h5-6H,1-4H2 |
| InChIKey | RWCKXGQFHADPKK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|