C19H36O12 — CID 58201978
(3R,4S,5R)-2-[(4S,5S,6R)-4,5-dihydroxy-6-[(2R,3R,4S)-1,3,4-trihydroxy-6,6-dimethylheptan-2-yl]oxyoxan-3-yl]oxyoxane-3,4,5-triol (PubChem CID 58201978) has the molecular formula C19H36O12 and a molecular weight of 456.49 g/mol. Its IUPAC name is (3R,4S,5R)-2-[(4S,5S,6R)-4,5-dihydroxy-6-[(2R,3R,4S)-1,3,4-trihydroxy-6,6-dimethylheptan-2-yl]oxyoxan-3-yl]oxyoxane-3,4,5-triol.
| Compound Name | (3R,4S,5R)-2-[(4S,5S,6R)-4,5-dihydroxy-6-[(2R,3R,4S)-1,3,4-trihydroxy-6,6-dimethylheptan-2-yl]oxyoxan-3-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 58201978 |
| Molecular Formula | C19H36O12 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | (3R,4S,5R)-2-[(4S,5S,6R)-4,5-dihydroxy-6-[(2R,3R,4S)-1,3,4-trihydroxy-6,6-dimethylheptan-2-yl]oxyoxan-3-yl]oxyoxane-3,4,5-triol |
| SMILES | CC(C)(C)C[C@H](O)[C@@H](O)[C@@H](CO)O[C@H]1OCC(OC2OC[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H36O12/c1-19(2,3)4-8(21)12(23)10(5-20)30-18-16(27)14(25)11(7-29-18)31-17-15(26)13(24)9(22)6-28-17/h8-18,20-27H,4-7H2,1-3H3/t8-,9+,10+,11?,12+,13-,14+,15+,16-,17?,18+/m0/s1 |
| InChIKey | HWORCWGWPDSLLK-MWPPQKPCSA-N |
| XLogP | -3.58 |
| TPSA | 198.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |