C13H27NO5 — CID 58201991
N-[(4S,5R,6R,7R)-6,7,8-trihydroxy-5-methoxy-2,2-dimethyloctan-4-yl]acetamide (PubChem CID 58201991) has the molecular formula C13H27NO5 and a molecular weight of 277.36 g/mol. Its IUPAC name is N-[(4S,5R,6R,7R)-6,7,8-trihydroxy-5-methoxy-2,2-dimethyloctan-4-yl]acetamide.
| Compound Name | N-[(4S,5R,6R,7R)-6,7,8-trihydroxy-5-methoxy-2,2-dimethyloctan-4-yl]acetamide |
|---|---|
| PubChem CID | 58201991 |
| Molecular Formula | C13H27NO5 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | N-[(4S,5R,6R,7R)-6,7,8-trihydroxy-5-methoxy-2,2-dimethyloctan-4-yl]acetamide |
| SMILES | CO[C@@H]([C@H](O)[C@H](O)CO)[C@H](CC(C)(C)C)NC(C)=O |
| InChI | InChI=1S/C13H27NO5/c1-8(16)14-9(6-13(2,3)4)12(19-5)11(18)10(17)7-15/h9-12,15,17-18H,6-7H2,1-5H3,(H,14,16)/t9-,10+,11+,12+/m0/s1 |
| InChIKey | DHPDSRKDKWDFKR-IRCOFANPSA-N |
| XLogP | -0.34 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |