C10H21FO4 — CID 58202053
(2R,3S,4S,5S)-5-fluoro-7,7-dimethyloctane-1,2,3,4-tetrol (PubChem CID 58202053) has the molecular formula C10H21FO4 and a molecular weight of 224.27 g/mol. Its IUPAC name is (2R,3S,4S,5S)-5-fluoro-7,7-dimethyloctane-1,2,3,4-tetrol.
| Compound Name | (2R,3S,4S,5S)-5-fluoro-7,7-dimethyloctane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 58202053 |
| Molecular Formula | C10H21FO4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (2R,3S,4S,5S)-5-fluoro-7,7-dimethyloctane-1,2,3,4-tetrol |
| SMILES | CC(C)(C)C[C@H](F)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H21FO4/c1-10(2,3)4-6(11)8(14)9(15)7(13)5-12/h6-9,12-15H,4-5H2,1-3H3/t6-,7+,8+,9-/m0/s1 |
| InChIKey | DQQNXBKOQWHRJB-KDXUFGMBSA-N |
| XLogP | -0.16 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |