C18H14ClI2N5O2 — CID 58202285
2-(3-chloro-2-pyridinyl)-N-[2,4-diiodo-6-(methylcarbamoyl)phenyl]-5-methylpyrazole-3-carboxamide (PubChem CID 58202285) has the molecular formula C18H14ClI2N5O2 and a molecular weight of 621.60 g/mol. Its IUPAC name is 2-(3-chloro-2-pyridinyl)-N-[2,4-diiodo-6-(methylcarbamoyl)phenyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 2-(3-chloro-2-pyridinyl)-N-[2,4-diiodo-6-(methylcarbamoyl)phenyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 58202285 |
| Molecular Formula | C18H14ClI2N5O2 |
| Molecular Weight | 621.60 g/mol |
| Exact Mass | 620.89 |
| IUPAC Name | 2-(3-chloro-2-pyridinyl)-N-[2,4-diiodo-6-(methylcarbamoyl)phenyl]-5-methylpyrazole-3-carboxamide |
| SMILES | CNC(=O)c1cc(I)cc(I)c1NC(=O)c1cc(C)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C18H14ClI2N5O2/c1-9-6-14(26(25-9)16-12(19)4-3-5-23-16)18(28)24-15-11(17(27)22-2)7-10(20)8-13(15)21/h3-8H,1-2H3,(H,22,27)(H,24,28) |
| InChIKey | LBHMITSPXUEPKL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|