About CID 58203017
CID 58203017 (PubChem CID 58203017) has the molecular formula C48H52N5O3Re-
and a molecular weight of 933.18 g/mol.
Molecular Properties
| Compound Name | CID 58203017 |
| PubChem CID | 58203017 |
| Molecular Formula | C48H52N5O3Re- |
| Molecular Weight | 933.18 g/mol |
| Exact Mass | 933.36 |
| IUPAC Name | — |
| SMILES | [Re].[c-]1c(-c2ccccn2)c2cc(c1-c1ccccn1)OCCCCCCCCOc1ccc(nc1)-c1cccc(n1)-c1ccc(cn1)OCCCCCCCCC2 |
| InChI | InChI=1S/C48H52N5O3.Re/c1-2-6-10-19-37-33-48(41(43-21-12-14-29-50-43)34-40(37)42-20-11-13-28-49-42)56-32-17-9-5-4-8-16-31-55-39-25-27-45(52-36-39)47-23-18-22-46(53-47)44-26-24-38(35-51-44)54-30-15-7-3-1;/h11-14,18,20-29,33,35-36H,1-10,15-17,19,30-32H2;/q-1; |
| InChIKey | MEHMCYVKSPJQKT-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 92.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 933.18 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 58203017 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58203017?
The IUPAC name of CID 58203017 (CID 58203017) is not available.
What is the SMILES notation for CID 58203017?
The canonical SMILES for CID 58203017 is [Re].[c-]1c(-c2ccccn2)c2cc(c1-c1ccccn1)OCCCCCCCCOc1ccc(nc1)-c1cccc(n1)-c1ccc(cn1)OCCCCCCCCC2.
What is the InChIKey of CID 58203017?
The InChIKey is MEHMCYVKSPJQKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H52N5O3.Re/c1-2-6-10-19-37-33-48(41(43-21-12-14-29-50-43)34-40(37)42-20-11-13-28-49-42)56-32-17-9-5-4-8-16-31-55-39-25-27-45(52-36-39)47-23-18-22-46(53-47)44-26-24-38(35-51-44)54-30-15-7-3-1;/h11-14,18,20-29,33,35-36H,1-10,15-17,19,30-32H2;/q-1;.
What are the key properties of CID 58203017?
CID 58203017 has a molecular weight of 933.18 g/mol, XLogP of 11.59, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58203017 is sourced from PubChem (CID 58203017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).