C18H15F2N4O2+ — CID 58203026
(6-carboxy-2-pyridinyl)-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]-dimethylazanium (PubChem CID 58203026) has the molecular formula C18H15F2N4O2+ and a molecular weight of 357.34 g/mol. Its IUPAC name is (6-carboxy-2-pyridinyl)-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]-dimethylazanium.
| Compound Name | (6-carboxy-2-pyridinyl)-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]-dimethylazanium |
|---|---|
| PubChem CID | 58203026 |
| Molecular Formula | C18H15F2N4O2+ |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (6-carboxy-2-pyridinyl)-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]-dimethylazanium |
| SMILES | C[N+](C)(c1cccc(C(=O)O)n1)c1cccc(-c2ccc(F)nc2F)n1 |
| InChI | InChI=1S/C18H14F2N4O2/c1-24(2,16-8-4-6-13(22-16)18(25)26)15-7-3-5-12(21-15)11-9-10-14(19)23-17(11)20/h3-10H,1-2H3/p+1 |
| InChIKey | NTBFEBPPDMAHEG-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|