C26H13F4NO2S — CID 58203048
4,5,6,7-tetrafluoro-2-[[5-(N-phenylanilino)thiophen-2-yl]methylidene]indene-1,3-dione (PubChem CID 58203048) has the molecular formula C26H13F4NO2S and a molecular weight of 479.45 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-2-[[5-(N-phenylanilino)thiophen-2-yl]methylidene]indene-1,3-dione.
| Compound Name | 4,5,6,7-tetrafluoro-2-[[5-(N-phenylanilino)thiophen-2-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 58203048 |
| Molecular Formula | C26H13F4NO2S |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 4,5,6,7-tetrafluoro-2-[[5-(N-phenylanilino)thiophen-2-yl]methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2ccc(N(c3ccccc3)c3ccccc3)s2)C(=O)c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C26H13F4NO2S/c27-21-19-20(22(28)24(30)23(21)29)26(33)17(25(19)32)13-16-11-12-18(34-16)31(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13H |
| InChIKey | LNYHPMUIHLNLRE-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|