C19H10ClF2NO3S — CID 58203941
1-(13-chloro-9-oxa-3-thia-14-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-4-yl)-2-(2,4-difluorophenyl)ethane-1,2-dione (PubChem CID 58203941) has the molecular formula C19H10ClF2NO3S and a molecular weight of 405.81 g/mol. Its IUPAC name is 1-(13-chloro-9-oxa-3-thia-14-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-4-yl)-2-(2,4-difluorophenyl)ethane-1,2-dione.
| Compound Name | 1-(13-chloro-9-oxa-3-thia-14-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-4-yl)-2-(2,4-difluorophenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 58203941 |
| Molecular Formula | C19H10ClF2NO3S |
| Molecular Weight | 405.81 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | 1-(13-chloro-9-oxa-3-thia-14-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-4-yl)-2-(2,4-difluorophenyl)ethane-1,2-dione |
| SMILES | O=C(C(=O)c1ccc(F)cc1F)c1cc2c(s1)-c1nc(Cl)ccc1OCC2 |
| InChI | InChI=1S/C19H10ClF2NO3S/c20-15-4-3-13-16(23-15)19-9(5-6-26-13)7-14(27-19)18(25)17(24)11-2-1-10(21)8-12(11)22/h1-4,7-8H,5-6H2 |
| InChIKey | NEUHOBPUGFUDTG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.81 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|