C16H14F3N5OS — CID 58204016
[2-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-4,5-dihydro-[1]benzoxepino[5,4-d][1,3]thiazol-8-yl]methanamine (PubChem CID 58204016) has the molecular formula C16H14F3N5OS and a molecular weight of 381.38 g/mol. Its IUPAC name is [2-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-4,5-dihydro-[1]benzoxepino[5,4-d][1,3]thiazol-8-yl]methanamine.
| Compound Name | [2-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-4,5-dihydro-[1]benzoxepino[5,4-d][1,3]thiazol-8-yl]methanamine |
|---|---|
| PubChem CID | 58204016 |
| Molecular Formula | C16H14F3N5OS |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | [2-[2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-4,5-dihydro-[1]benzoxepino[5,4-d][1,3]thiazol-8-yl]methanamine |
| SMILES | NCc1ccc2c(c1)OCCc1sc(-c3ncnn3CC(F)(F)F)nc1-2 |
| InChI | InChI=1S/C16H14F3N5OS/c17-16(18,19)7-24-14(21-8-22-24)15-23-13-10-2-1-9(6-20)5-11(10)25-4-3-12(13)26-15/h1-2,5,8H,3-4,6-7,20H2 |
| InChIKey | VJILQRHGFXUZEN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |