About 3-(methoxymethyl)-1,5-di(propan-2-yl)-1,2,4-triazole
3-(methoxymethyl)-1,5-di(propan-2-yl)-1,2,4-triazole (PubChem CID 58204416) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is 3-(methoxymethyl)-1,5-di(propan-2-yl)-1,2,4-triazole.
Molecular Properties
| Compound Name | 3-(methoxymethyl)-1,5-di(propan-2-yl)-1,2,4-triazole |
| PubChem CID | 58204416 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 3-(methoxymethyl)-1,5-di(propan-2-yl)-1,2,4-triazole |
| SMILES | COCc1nc(C(C)C)n(C(C)C)n1 |
| InChI | InChI=1S/C10H19N3O/c1-7(2)10-11-9(6-14-5)12-13(10)8(3)4/h7-8H,6H2,1-5H3 |
| InChIKey | PTYQFBKYXUQPRV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(methoxymethyl)-1,5-di(propan-2-yl)-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methoxymethyl)-1,5-di(propan-2-yl)-1,2,4-triazole?
The IUPAC name of 3-(methoxymethyl)-1,5-di(propan-2-yl)-1,2,4-triazole (CID 58204416) is 3-(methoxymethyl)-1,5-di(propan-2-yl)-1,2,4-triazole.
What is the SMILES notation for 3-(methoxymethyl)-1,5-di(propan-2-yl)-1,2,4-triazole?
The canonical SMILES for 3-(methoxymethyl)-1,5-di(propan-2-yl)-1,2,4-triazole is COCc1nc(C(C)C)n(C(C)C)n1.
What is the InChIKey of 3-(methoxymethyl)-1,5-di(propan-2-yl)-1,2,4-triazole?
The InChIKey is PTYQFBKYXUQPRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O/c1-7(2)10-11-9(6-14-5)12-13(10)8(3)4/h7-8H,6H2,1-5H3.
What are the key properties of 3-(methoxymethyl)-1,5-di(propan-2-yl)-1,2,4-triazole?
3-(methoxymethyl)-1,5-di(propan-2-yl)-1,2,4-triazole has a molecular weight of 197.28 g/mol, XLogP of 2.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methoxymethyl)-1,5-di(propan-2-yl)-1,2,4-triazole is sourced from PubChem (CID 58204416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).