C43H85NO2 — CID 58205079
N,N-dimethyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]-2-(3,7,11,15-tetramethylhexadecoxy)propan-1-amine (PubChem CID 58205079) has the molecular formula C43H85NO2 and a molecular weight of 648.16 g/mol. Its IUPAC name is N,N-dimethyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]-2-(3,7,11,15-tetramethylhexadecoxy)propan-1-amine.
| Compound Name | N,N-dimethyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]-2-(3,7,11,15-tetramethylhexadecoxy)propan-1-amine |
|---|---|
| PubChem CID | 58205079 |
| Molecular Formula | C43H85NO2 |
| Molecular Weight | 648.16 g/mol |
| Exact Mass | 647.66 |
| IUPAC Name | N,N-dimethyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]-2-(3,7,11,15-tetramethylhexadecoxy)propan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(CN(C)C)OCCC(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C43H85NO2/c1-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-35-45-38-43(37-44(7)8)46-36-34-42(6)33-27-32-41(5)31-26-30-40(4)29-25-28-39(2)3/h13-14,16-17,39-43H,9-12,15,18-38H2,1-8H3/b14-13-,17-16- |
| InChIKey | MLUIKVWKXRYFJS-AUGURXLVSA-N |
| XLogP | 13.23 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.16 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|