C43H81NO2 — CID 58205090
N,N-diethyl-2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine (PubChem CID 58205090) has the molecular formula C43H81NO2 and a molecular weight of 644.13 g/mol. Its IUPAC name is N,N-diethyl-2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine.
| Compound Name | N,N-diethyl-2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine |
|---|---|
| PubChem CID | 58205090 |
| Molecular Formula | C43H81NO2 |
| Molecular Weight | 644.13 g/mol |
| Exact Mass | 643.63 |
| IUPAC Name | N,N-diethyl-2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(CN(CC)CC)OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C43H81NO2/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-45-42-43(41-44(7-3)8-4)46-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2/h15-18,21-24,43H,5-14,19-20,25-42H2,1-4H3/b17-15-,18-16-,23-21-,24-22- |
| InChIKey | WWNMYEIIUSAUFU-MLLZQYMOSA-N |
| XLogP | 13.36 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.13 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|