C44H81NO3 — CID 58205093
1-[2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl]piperidin-4-ol (PubChem CID 58205093) has the molecular formula C44H81NO3 and a molecular weight of 672.14 g/mol. Its IUPAC name is 1-[2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl]piperidin-4-ol.
| Compound Name | 1-[2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 58205093 |
| Molecular Formula | C44H81NO3 |
| Molecular Weight | 672.14 g/mol |
| Exact Mass | 671.62 |
| IUPAC Name | 1-[2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyl]piperidin-4-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(CN1CCC(O)CC1)OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C44H81NO3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-39-47-42-44(41-45-37-35-43(46)36-38-45)48-40-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,43-44,46H,3-10,15-16,21-42H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | ZVWXSBHUQQKHMJ-MAZCIEHSSA-N |
| XLogP | 12.47 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.14 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|