About 2-tert-butyl-5-(5,5-dimethylhexyl)pyrazine
2-tert-butyl-5-(5,5-dimethylhexyl)pyrazine (PubChem CID 58205117) has the molecular formula C16H28N2
and a molecular weight of 248.41 g/mol. Its IUPAC name is 2-tert-butyl-5-(5,5-dimethylhexyl)pyrazine.
Molecular Properties
| Compound Name | 2-tert-butyl-5-(5,5-dimethylhexyl)pyrazine |
| PubChem CID | 58205117 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 2-tert-butyl-5-(5,5-dimethylhexyl)pyrazine |
| SMILES | CC(C)(C)CCCCc1cnc(C(C)(C)C)cn1 |
| InChI | InChI=1S/C16H28N2/c1-15(2,3)10-8-7-9-13-11-18-14(12-17-13)16(4,5)6/h11-12H,7-10H2,1-6H3 |
| InChIKey | BPVDNOLWNAWKQY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-5-(5,5-dimethylhexyl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-(5,5-dimethylhexyl)pyrazine?
The IUPAC name of 2-tert-butyl-5-(5,5-dimethylhexyl)pyrazine (CID 58205117) is 2-tert-butyl-5-(5,5-dimethylhexyl)pyrazine.
What is the SMILES notation for 2-tert-butyl-5-(5,5-dimethylhexyl)pyrazine?
The canonical SMILES for 2-tert-butyl-5-(5,5-dimethylhexyl)pyrazine is CC(C)(C)CCCCc1cnc(C(C)(C)C)cn1.
What is the InChIKey of 2-tert-butyl-5-(5,5-dimethylhexyl)pyrazine?
The InChIKey is BPVDNOLWNAWKQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2/c1-15(2,3)10-8-7-9-13-11-18-14(12-17-13)16(4,5)6/h11-12H,7-10H2,1-6H3.
What are the key properties of 2-tert-butyl-5-(5,5-dimethylhexyl)pyrazine?
2-tert-butyl-5-(5,5-dimethylhexyl)pyrazine has a molecular weight of 248.41 g/mol, XLogP of 4.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-(5,5-dimethylhexyl)pyrazine is sourced from PubChem (CID 58205117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).