C64H58N2O4 — CID 58205408
[4-[4-(2,3-dimethylphenyl)-N-[4-[1-[4-[4-(2,3-dimethylphenyl)-N-(4-prop-2-enoyloxyphenyl)anilino]phenyl]cyclohexyl]phenyl]anilino]phenyl] prop-2-enoate (PubChem CID 58205408) has the molecular formula C64H58N2O4 and a molecular weight of 919.18 g/mol. Its IUPAC name is [4-[4-(2,3-dimethylphenyl)-N-[4-[1-[4-[4-(2,3-dimethylphenyl)-N-(4-prop-2-enoyloxyphenyl)anilino]phenyl]cyclohexyl]phenyl]anilino]phenyl] prop-2-enoate.
| Compound Name | [4-[4-(2,3-dimethylphenyl)-N-[4-[1-[4-[4-(2,3-dimethylphenyl)-N-(4-prop-2-enoyloxyphenyl)anilino]phenyl]cyclohexyl]phenyl]anilino]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 58205408 |
| Molecular Formula | C64H58N2O4 |
| Molecular Weight | 919.18 g/mol |
| Exact Mass | 918.44 |
| IUPAC Name | [4-[4-(2,3-dimethylphenyl)-N-[4-[1-[4-[4-(2,3-dimethylphenyl)-N-(4-prop-2-enoyloxyphenyl)anilino]phenyl]cyclohexyl]phenyl]anilino]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(N(c2ccc(-c3cccc(C)c3C)cc2)c2ccc(C3(c4ccc(N(c5ccc(OC(=O)C=C)cc5)c5ccc(-c6cccc(C)c6C)cc5)cc4)CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C64H58N2O4/c1-7-62(67)69-58-38-34-56(35-39-58)65(52-26-18-48(19-27-52)60-16-12-14-44(3)46(60)5)54-30-22-50(23-31-54)64(42-10-9-11-43-64)51-24-32-55(33-25-51)66(57-36-40-59(41-37-57)70-63(68)8-2)53-28-20-49(21-29-53)61-17-13-15-45(4)47(61)6/h7-8,12-41H,1-2,9-11,42-43H2,3-6H3 |
| InChIKey | JWHCAHPIGHMMLQ-UHFFFAOYSA-N |
| XLogP | 16.63 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.18 |
| LogP ≤ 5 | 16.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|