C47H46N2O2 — CID 58205411
[2-methyl-5-(4-methyl-N-[4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]propan-2-yl]phenyl]anilino)phenyl] 2-methylprop-2-enoate (PubChem CID 58205411) has the molecular formula C47H46N2O2 and a molecular weight of 670.90 g/mol. Its IUPAC name is [2-methyl-5-(4-methyl-N-[4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]propan-2-yl]phenyl]anilino)phenyl] 2-methylprop-2-enoate.
| Compound Name | [2-methyl-5-(4-methyl-N-[4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]propan-2-yl]phenyl]anilino)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58205411 |
| Molecular Formula | C47H46N2O2 |
| Molecular Weight | 670.90 g/mol |
| Exact Mass | 670.36 |
| IUPAC Name | [2-methyl-5-(4-methyl-N-[4-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]propan-2-yl]phenyl]anilino)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cc(N(c2ccc(C)cc2)c2ccc(C(C)(C)c3ccc(N(c4ccc(C)cc4)c4ccc(C)cc4)cc3)cc2)ccc1C |
| InChI | InChI=1S/C47H46N2O2/c1-32(2)46(50)51-45-31-44(26-15-36(45)6)49(41-24-13-35(5)14-25-41)43-29-18-38(19-30-43)47(7,8)37-16-27-42(28-17-37)48(39-20-9-33(3)10-21-39)40-22-11-34(4)12-23-40/h9-31H,1H2,2-8H3 |
| InChIKey | QKMUJZBSTDYSTC-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.90 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|